Alisol F structure
|
Common Name | Alisol F | ||
|---|---|---|---|---|
| CAS Number | 155521-45-2 | Molecular Weight | 488.699 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 617.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.6±25.0 °C | |
Use of Alisol FAlisol F is a natural product. |
| Name | Alisol F |
|---|---|
| Synonym | More Synonyms |
| Description | Alisol F is a natural product. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 617.4±55.0 °C at 760 mmHg |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.699 |
| Flash Point | 194.6±25.0 °C |
| Exact Mass | 488.350189 |
| LogP | 3.77 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | YNKJSQIXVXWFBK-SLGDLKFASA-N |
| SMILES | CC1CC(C(O)C(C)(C)O)OC2CC3(C)C(=C12)CC(O)C1C2(C)CCC(=O)C(C)(C)C2CCC13C |
| Storage condition | 2-8℃ |
| Dammar-13(17)-en-3-one, 16,23-epoxy-11,24,25-trihydroxy-, (8α,9β,11β,14β,16β,23S,24R)- |
| (8α,9β,11β,14β,16β,23S,24R)-11,24,25-Trihydroxy-16,23-epoxydammar-13(17)-en-3-one |
| (8alpha,9beta,11beta,14beta,16beta,23S,24R)-16,23-Epoxy-11,24,25-trihydroxydammar-13(17)-en-3-one |