2-Fluoro-3-(tributylstannyl)pyridine structure
|
Common Name | 2-Fluoro-3-(tributylstannyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 155533-81-6 | Molecular Weight | 386.12600 | |
| Density | 1.176 g/mL at 25ºC | Boiling Point | 384.343ºC at 760 mmHg | |
| Molecular Formula | C17H30FNSn | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 110ºC | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | tributyl-(2-fluoropyridin-3-yl)stannane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176 g/mL at 25ºC |
|---|---|
| Boiling Point | 384.343ºC at 760 mmHg |
| Molecular Formula | C17H30FNSn |
| Molecular Weight | 386.12600 |
| Flash Point | 110ºC |
| Exact Mass | 387.13800 |
| PSA | 12.89000 |
| LogP | 5.27680 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | n20/D 1.508 |
| InChIKey | UEIDBUBBTLTCOP-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cccnc1F |
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H315-H319-H372-H410 |
| Precautionary Statements | P273-P280-P301 + P310-P305 + P351 + P338-P314-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | R21 |
| Safety Phrases | S35 |
| RIDADR | UN 2788 6.1/PG 3 |
| Hazard Class | 6.1 |
| HS Code | 2933399090 |
|
~%
2-Fluoro-3-(tri... CAS#:155533-81-6 |
| Literature: US5919779 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Fluoro-3-(tributylstannyl)pyridine |
| 2-fluoro-3-(tributylstannanyl)pyridine |
| 3-tributylstannyl-2-fluoropyridine |
| PC8517 |