Pyr-Arg-Thr-Lys-Arg-AMC trifluoroacetate salt structure
|
Common Name | Pyr-Arg-Thr-Lys-Arg-AMC trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 155575-02-3 | Molecular Weight | 827.93 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H57N13O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pyr-Arg-Thr-Lys-Arg-AMC trifluoroacetate saltPyr-Arg-Thr-Lys-Arg-AMC is a AMC peptide. AMC is a decapeptide that is specifically hydrolyzed by proteases such as trypsin and thrombin. The AMC peptide can be used to determine the activity of protease and the potency of enzyme inhibitors[1]. |
| Name | l-pyroglutamyl-l-arginyl-l-threonyl-l-lysyl-l-arginine 4-methylcoumaryl-7-amide |
|---|
| Description | Pyr-Arg-Thr-Lys-Arg-AMC is a AMC peptide. AMC is a decapeptide that is specifically hydrolyzed by proteases such as trypsin and thrombin. The AMC peptide can be used to determine the activity of protease and the potency of enzyme inhibitors[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C37H57N13O9 |
|---|---|
| Molecular Weight | 827.93 |
| Exact Mass | 827.44000 |
| PSA | 374.86000 |
| LogP | 2.34160 |
| InChIKey | ZJRJBAKJWMHKFK-URVADDRRSA-N |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)C(CCCN=C(N)N)NC(=O)C(CCCCN)NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C3CCC(=O)N3)C(C)O)ccc12 |
| WGK Germany | 3 |
|---|