Avitinib structure
|
Common Name | Avitinib | ||
|---|---|---|---|---|
| CAS Number | 1557267-42-1 | Molecular Weight | 487.529 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C26H26FN7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AvitinibAvitinib (AC0010) is an irreversible, mutant-selective EGFR inhibitor that effectively inhibits EGFR T790M resistance mutations in non-small cell lung cancer (NSCLC). Abivertinib is also a novel BTK inhibitor. |
| Name | N-{3-[(2-{[3-Fluoro-4-(4-methyl-1-piperazinyl)phenyl]amino}-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]phenyl}acrylamide |
|---|---|
| Synonym | More Synonyms |
| Description | Avitinib (AC0010) is an irreversible, mutant-selective EGFR inhibitor that effectively inhibits EGFR T790M resistance mutations in non-small cell lung cancer (NSCLC). Abivertinib is also a novel BTK inhibitor. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C26H26FN7O2 |
| Molecular Weight | 487.529 |
| Exact Mass | 487.213196 |
| LogP | 3.50 |
| Index of Refraction | 1.697 |
| InChIKey | UOFYSRZSLXWIQB-UHFFFAOYSA-N |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)c(F)c3)nc3[nH]ccc23)c1 |
| Storage condition | -20℃ |
| N-{3-[(2-{[3-Fluoro-4-(4-methyl-1-piperazinyl)phenyl]amino}-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]phenyl}acrylamide |
| 2-Propenamide, N-[3-[[2-[[3-fluoro-4-(4-methyl-1-piperazinyl)phenyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]- |
| Avitinib |
| Avi Tini |