5(4H)-Oxazolone,4-[(4-chlorophenyl)methylene]-2-phenyl structure
|
Common Name | 5(4H)-Oxazolone,4-[(4-chlorophenyl)methylene]-2-phenyl | ||
|---|---|---|---|---|
| CAS Number | 15601-44-2 | Molecular Weight | 283.70900 | |
| Density | 1.27g/cm3 | Boiling Point | 420.2ºC at 760mmHg | |
| Molecular Formula | C16H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.9ºC | |
| Name | (E,Z)-4-(4-chlorobenzylidene)-2-phenyl-4,5-dihydrooxazol-5-one |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 420.2ºC at 760mmHg |
| Molecular Formula | C16H10ClNO2 |
| Molecular Weight | 283.70900 |
| Flash Point | 207.9ºC |
| Exact Mass | 283.04000 |
| PSA | 38.66000 |
| LogP | 3.12010 |
| Vapour Pressure | 2.87E-07mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | PKMDOGQJFLVZEJ-UVTDQMKNSA-N |
| SMILES | O=C1OC(c2ccccc2)=NC1=Cc1ccc(Cl)cc1 |
| Precursor 7 | |
|---|---|
| DownStream 5 | |
|
Name: Dicer-mediated maturation of pre-microRNA
Source: Center for Chemical Genomics, University of Michigan
Target: N/A
External Id: TargetID_659_CEMA
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|