PyAOP structure
|
Common Name | PyAOP | ||
|---|---|---|---|---|
| CAS Number | 156311-83-0 | Molecular Weight | 521.38100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H27F6N7OP2 | Melting Point | 163-168 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (7-Azabenzotriazol-1-yloxy)tripyrrolidinophosphonium hexafluorophosphate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 163-168 °C(lit.) |
|---|---|
| Molecular Formula | C17H27F6N7OP2 |
| Molecular Weight | 521.38100 |
| Exact Mass | 521.16600 |
| PSA | 89.73000 |
| LogP | 5.41600 |
| InChIKey | CBZAHNDHLWAZQC-UHFFFAOYSA-N |
| SMILES | F[P-](F)(F)(F)(F)F.c1cnc2c(c1)nnn2O[P+](N1CCCC1)(N1CCCC1)N1CCCC1 |
| Storage condition | ?20°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Secondary Structural Preferences of Some Antibacterial Cyclooctapeptides in the Presence of Calcium(II).
Int J Med Chem 2012 , 730239, (2014) The purpose of this study is to understand the interactions of some antibacterial cationic amphipathic cyclooctapeptides with calcium(II) and their secondary structural preferences. The thermodynamic ... |
| Tri(pyrrolidin-1-yl)(3H-[1,2,3]triazolo[4,5-b]pyridin-3-yloxy)phosphonium hexafluorophosphate |
| tripyrrolidin-1-yl(triazolo[4,5-b]pyridin-3-yloxy)phosphanium,hexafluorophosphate |
| PyAOP |
| Tripyrrolidin-1-yl(3H-[1,2,3]triazolo[4,5-b]pyridin-3-yloxy)phosphonium hexafluorophosphate |
| MFCD03703417 |
| Tri-1-pyrrolidinyl(3H-[1,2,3]triazolo[4,5-b]pyridin-3-yloxy)phosphonium hexafluorophosphate |
| (3-Hydroxy-3H-1,2,3-triazolo[4,5-b]pyridinato-O)tri-1-pyrrolidinylphosphonium hexafluorophosphate |