menthyl propylene glycol carbonate structure
|
Common Name | menthyl propylene glycol carbonate | ||
|---|---|---|---|---|
| CAS Number | 156324-82-2 | Molecular Weight | 258.35400 | |
| Density | 1.02g/cm3 | Boiling Point | 546.7ºC at 760mmHg | |
| Molecular Formula | C14H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.5ºC | |
| Name | 2-hydroxypropyl (5-methyl-2-propan-2-ylcyclohexyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 546.7ºC at 760mmHg |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.35400 |
| Flash Point | 167.5ºC |
| Exact Mass | 258.18300 |
| PSA | 55.76000 |
| LogP | 2.98120 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.469 |
| InChIKey | FLYJSXDJKBHQAU-UHFFFAOYSA-N |
| SMILES | CC(O)COC(=O)OC1CC(C)CCC1C(C)C |
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
|---|---|
| Risk Phrases | 36-51/53 |
| Safety Phrases | 26-61 |
| Menthyl 2-hydroxypropyl carbonate |
| Carbonic acid,2-hydroxypropyl 5-methyl-2-(1-methylethyl)cyclohexyl ester |
| 2-hydroxypropyl [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] carbonate |
| FrescolatMPC |