Carbinol(Hydroxyl)Terminated Poly Dimethylsiloxanes structure
|
Common Name | Carbinol(Hydroxyl)Terminated Poly Dimethylsiloxanes | ||
|---|---|---|---|---|
| CAS Number | 156327-07-0 | Molecular Weight | 406.925 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 449.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C9H6Cl6O3S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 225.8±28.7 °C | |
| Name | Poly(dimethylsiloxane), bis(hydroxyalkyl) terminated |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 449.7±45.0 °C at 760 mmHg |
| Molecular Formula | C9H6Cl6O3S |
| Molecular Weight | 406.925 |
| Flash Point | 225.8±28.7 °C |
| Exact Mass | 403.816895 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | BGHSBLYBOOUZFE-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCCOCCO)O[Si](C)(C)CCCOCCO |
| Storage condition | 2~8℃,Seal |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| thiodan |
| 6,7,8,9,10,10-Hexachloro-1,5,5a,6,9',9a-hexahydro-6,9-methano-2,4,3-benzodioxathiepin 3-Oxide |
| EINECS 204-079-4 |
| Niagara 5462 |
| MFCD01324943 |
| 1,9,10,11,12,12-Hexachloro-4,6-dioxa-5-thiatricyclo[7.2.1.0]dodec-10-ene 5-oxide |
| 1,9,10,11,12,12-Hexachloro-4,6-dioxa-5-thiatricyclo[7.2.1.0]dodéc-10-ène-5-oxyde |
| 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-6,9-methano-2,4,3-benzodioxathiepine 3-oxide |
| 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide |