A-1293102
Modify Date: 2024-04-06 13:34:16
A-1293102 structure
|
Common Name | A-1293102 | ||
|---|---|---|---|---|
| CAS Number | 1565759-96-7 | Molecular Weight | 972.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H40F3N7O7S5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of A-1293102A-1293102 is a potent and selective BCL-XL inhibitor that kills BCL-XL-dependent tumor cells[1]. |
| Name | A-1293102 |
|---|
| Description | A-1293102 is a potent and selective BCL-XL inhibitor that kills BCL-XL-dependent tumor cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C42H40F3N7O7S5 |
|---|---|
| Molecular Weight | 972.13 |
| InChIKey | GSXZYBFDAFXVFZ-MUUNZHRXSA-N |
| SMILES | O=C(NS(=O)(=O)c1ccc(NC(CCN2CCOCC2)CSc2ccccc2)c(S(=O)(=O)C(F)(F)F)c1)c1csc(N2CCc3cccc(C(=O)Nc4nc5ccccc5s4)c3C2)n1 |