7-(4-Fluoro-phenyl)-4,7-dioxo-heptanoic acid structure
|
Common Name | 7-(4-Fluoro-phenyl)-4,7-dioxo-heptanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1566-06-9 | Molecular Weight | 252.23800 | |
| Density | N/A | Boiling Point | 460.5ºC at 760mmHg | |
| Molecular Formula | C13H13FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.3ºC | |
| Name | 7-(4-Fluoro-phenyl)-4,7-dioxo-heptanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 460.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C13H13FO4 |
| Molecular Weight | 252.23800 |
| Flash Point | 232.3ºC |
| Exact Mass | 252.08000 |
| PSA | 71.44000 |
| LogP | 2.22250 |
| Vapour Pressure | 2.82E-09mmHg at 25°C |
| InChIKey | KMZDIGSNWYUHIH-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)CCC(=O)c1ccc(F)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 7-(4-fluorophenyl)-4,7-dioxoheptanoic acid |