dde-lys(fmoc)-oh structure
|
Common Name | dde-lys(fmoc)-oh | ||
|---|---|---|---|---|
| CAS Number | 156648-40-7 | Molecular Weight | 532.627 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 750.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C31H36N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 407.5±32.9 °C | |
| Name | (2S)-2-[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethylamino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 750.1±60.0 °C at 760 mmHg |
| Molecular Formula | C31H36N2O6 |
| Molecular Weight | 532.627 |
| Flash Point | 407.5±32.9 °C |
| Exact Mass | 532.257324 |
| PSA | 121.80000 |
| LogP | 5.01 |
| Appearance of Characters | Powder | Off-white |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | HJGADLBSAXYSSH-VWLOTQADSA-N |
| SMILES | CC(=NC(CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)C1=C(O)CC(C)(C)CC1=O |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|
| N-[1-(4,4-Dimethyl-2,6-dioxocyclohexylidene)ethyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-lysine |
| AmbotzDAA1015 |
| L-Lysine, N-[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| Dde-Lys(Fmoc)-OH |