2,3-Difluoro-4-pentyloxyphenylboronic acid structure
|
Common Name | 2,3-Difluoro-4-pentyloxyphenylboronic acid | ||
|---|---|---|---|---|
| CAS Number | 156684-91-2 | Molecular Weight | 244.043 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 355.0±52.0 °C at 760 mmHg | |
| Molecular Formula | C11H15BF2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.5±30.7 °C | |
| Name | (2,3-difluoro-4-pentoxyphenyl)boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 355.0±52.0 °C at 760 mmHg |
| Molecular Formula | C11H15BF2O3 |
| Molecular Weight | 244.043 |
| Flash Point | 168.5±30.7 °C |
| Exact Mass | 244.108231 |
| PSA | 49.69000 |
| LogP | 3.64 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.483 |
| InChIKey | RCVQAXDDFSTKKQ-UHFFFAOYSA-N |
| SMILES | CCCCCOc1ccc(B(O)O)c(F)c1F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2,3-difluoro-4-pentoxyphenylboronic acid |
| 2,3-Difluoro-4-n-pentoxyphenylboronic acid |
| [2,3-Difluoro-4-(pentyloxy)phenyl]boronic acid |
| PC7032 |
| 2,3-Difluoro-4-pentyloxyphenylboronic acid |
| Boronic acid, B-[2,3-difluoro-4-(pentyloxy)phenyl]- |