Acetone 2,4-(dinitrophenyl)hydrazone structure
|
Common Name | Acetone 2,4-(dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 1567-89-1 | Molecular Weight | 238.200 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 370.3±52.0 °C at 760 mmHg | |
| Molecular Formula | C9H10N4O4 | Melting Point | 126-128 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 177.7±30.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | acetone 2,4-dinitrophenylhydrazone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 370.3±52.0 °C at 760 mmHg |
| Melting Point | 126-128 °C(lit.) |
| Molecular Formula | C9H10N4O4 |
| Molecular Weight | 238.200 |
| Flash Point | 177.7±30.7 °C |
| Exact Mass | 238.070206 |
| PSA | 116.03000 |
| LogP | 3.03 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | YGIXYAIGWMAGIB-UHFFFAOYSA-N |
| SMILES | CC(C)=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2928000090 |
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1-(2,4-Dinitrophenyl)-2-isopropylidenehydrazine |
| Acetone-DNPH |
| 2-Propanone, 2-(2,4-dinitrophenyl)hydrazone |
| MFCD00137172 |
| 2,4-dinitro-N-(propan-2-ylideneamino)aniline |
| Acetone-2,4-dinitrophenylhydrazone |
| Acetone 2,4-Dinitrophenylhydrazone |
| Acetone- 2,4-DNPH |