2-Propenal, 3-phenyl-,2-(3-phenyl-2-propen-1-ylidene)hydrazone structure
|
Common Name | 2-Propenal, 3-phenyl-,2-(3-phenyl-2-propen-1-ylidene)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 1568-11-2 | Molecular Weight | 260.33300 | |
| Density | 0.94g/cm3 | Boiling Point | 419.3ºC at 760mmHg | |
| Molecular Formula | C18H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200ºC | |
| Name | cinnamalazine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.94g/cm3 |
|---|---|
| Boiling Point | 419.3ºC at 760mmHg |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.33300 |
| Flash Point | 200ºC |
| Exact Mass | 260.13100 |
| PSA | 24.72000 |
| LogP | 4.46980 |
| Vapour Pressure | 7.46E-07mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | MIBXLDBZXACZIE-MKXOLOGGSA-N |
| SMILES | C(=Cc1ccccc1)C=NN=CC=Cc1ccccc1 |
| HS Code | 2928000090 |
|---|
|
~10%
2-Propenal, 3-p... CAS#:1568-11-2 |
| Literature: Nanjundaswamy; Pasha Synthetic Communications, 2006 , vol. 36, # 21 p. 3161 - 3165 |
|
~%
2-Propenal, 3-p... CAS#:1568-11-2 |
| Literature: Curtius; Jay Journal fuer Praktische Chemie (Leipzig), 1889 , vol. <2> 39, p. 52 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| CINNAMALDEHYDE AZINE |
| cinnammaldazine |
| dicinnamylidene-hydrazine |
| Dicinnamyliden-hydrazin |
| Dicinnamalhydrazin |
| cinnamaldazine |
| N,N'-bis-(3-phenyl-allylidene)-hydrazine |