Pyrrolifene structure
|
Common Name | Pyrrolifene | ||
|---|---|---|---|---|
| CAS Number | 15686-97-2 | Molecular Weight | 351.48200 | |
| Density | 1.078g/cm3 | Boiling Point | 476.7ºC at 760mmHg | |
| Molecular Formula | C23H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.9ºC | |
Use of PyrrolifenePyrrolifene is an analgesic with anti-inflammatory effect. |
| Name | Pyrrolifene |
|---|---|
| Synonym | More Synonyms |
| Description | Pyrrolifene is an analgesic with anti-inflammatory effect. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.078g/cm3 |
|---|---|
| Boiling Point | 476.7ºC at 760mmHg |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.48200 |
| Flash Point | 145.9ºC |
| Exact Mass | 351.22000 |
| PSA | 29.54000 |
| LogP | 4.35750 |
| Vapour Pressure | 2.99E-09mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | XPSOFSIDLMRECY-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(Cc1ccccc1)(c1ccccc1)C(C)CN1CCCC1 |
| Storage condition | 2-8℃ |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Acetic acid 1-benzyl-2-methyl-1-phenyl-3-(1-pyrrolidinyl)propyl ester |
| 2-acetoxy-3-methyl-1,2-diphenyl-4-pyrrolidino-butane |
| Unii-T5Q0wa2589 |
| Pyrroliphene |
| propiverine |