L-739594 structure
|
Common Name | L-739594 | ||
|---|---|---|---|---|
| CAS Number | 156879-13-9 | Molecular Weight | 557.72100 | |
| Density | 1.21g/cm3 | Boiling Point | 761.7ºC at 760mmHg | |
| Molecular Formula | C31H47N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 414.5ºC | |
Use of L-739594L-739594 is a HIV-1 protease inhibitor, with an IC50 of 1.8 nM[1]. |
| Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|
| Description | L-739594 is a HIV-1 protease inhibitor, with an IC50 of 1.8 nM[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 1.8 nM (HIV-1)[1]. |
| References |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 761.7ºC at 760mmHg |
| Molecular Formula | C31H47N3O6 |
| Molecular Weight | 557.72100 |
| Flash Point | 414.5ºC |
| Exact Mass | 557.34600 |
| PSA | 116.34000 |
| LogP | 4.22420 |
| Vapour Pressure | 2.16E-24mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | LQBLSQUSWJJCSP-UZIBIQIJSA-N |
| SMILES | CC(C)(C)NC(=O)C1CC2CCCCC2CN1CC(O)C(Cc1ccccc1)NC(=O)OC1COC2OCCC12 |