9H-Fluoren-9-ylmethyl (2-oxoethyl)carbamate structure
|
Common Name | 9H-Fluoren-9-ylmethyl (2-oxoethyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 156939-62-7 | Molecular Weight | 281.306 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 477.5±28.0 °C at 760 mmHg | |
| Molecular Formula | C17H15NO3 | Melting Point | 140-143°C | |
| MSDS | N/A | Flash Point | 242.6±24.0 °C | |
| Name | (9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 477.5±28.0 °C at 760 mmHg |
| Melting Point | 140-143°C |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.306 |
| Flash Point | 242.6±24.0 °C |
| Exact Mass | 281.105194 |
| PSA | 55.40000 |
| LogP | 3.33 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | DBTMQODRSDEGRZ-UHFFFAOYSA-N |
| SMILES | O=CCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (9H-Fluoren-9-yl)Methyl2-oxoEthylcarbamate |
| 9H-Fluoren-9-ylmethyl (2-oxoethyl)carbamate |
| Carbamic acid, N-(2-oxoethyl)-, 9H-fluoren-9-ylmethyl ester |