1-[(p-tolyl)methyl]cyclopropanecarbonyl chloride structure
|
Common Name | 1-[(p-tolyl)methyl]cyclopropanecarbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1570-86-1 | Molecular Weight | 208.68400 | |
| Density | 1.21g/cm3 | Boiling Point | 281.2ºC at 760 mmHg | |
| Molecular Formula | C12H13ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.9ºC | |
| Name | 1-[(4-methylphenyl)methyl]cyclopropane-1-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 281.2ºC at 760 mmHg |
| Molecular Formula | C12H13ClO |
| Molecular Weight | 208.68400 |
| Flash Point | 157.9ºC |
| Exact Mass | 208.06500 |
| PSA | 17.07000 |
| LogP | 3.08310 |
| Vapour Pressure | 0.00362mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | JNOQIWROIDIHDU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CC2(C(=O)Cl)CC2)cc1 |
| HS Code | 2916399090 |
|---|
|
~%
1-[(p-tolyl)met... CAS#:1570-86-1 |
| Literature: Kaiser; Leonard; Heil; Lester; Tedeschi; Zirkle Journal of medicinal chemistry, 1970 , vol. 13, # 5 p. 820 - 826 |
|
~%
1-[(p-tolyl)met... CAS#:1570-86-1 |
| Literature: Kaiser; Leonard; Heil; Lester; Tedeschi; Zirkle Journal of medicinal chemistry, 1970 , vol. 13, # 5 p. 820 - 826 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 216-383-4 |
| 1-[(p-tolyl)methyl]cyclopropanecarbonyl chloride |
| 1-(4-methylbenzyl)cyclopropanecarbonyl chloride |