2,6-dichloro-4-(trifluoromethyl)benzamide structure
|
Common Name | 2,6-dichloro-4-(trifluoromethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 157021-70-0 | Molecular Weight | 258.02500 | |
| Density | 1.558g/cm3 | Boiling Point | 226.2ºC at 760mmHg | |
| Molecular Formula | C8H4Cl2F3NO | Melting Point | 166ºC | |
| MSDS | N/A | Flash Point | 90.6ºC | |
| Name | 2,6-dichloro-4-(trifluoromethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.558g/cm3 |
|---|---|
| Boiling Point | 226.2ºC at 760mmHg |
| Melting Point | 166ºC |
| Molecular Formula | C8H4Cl2F3NO |
| Molecular Weight | 258.02500 |
| Flash Point | 90.6ºC |
| Exact Mass | 256.96200 |
| PSA | 43.09000 |
| LogP | 3.81140 |
| Vapour Pressure | 0.0828mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | OWAIJGGUONLHEI-UHFFFAOYSA-N |
| SMILES | NC(=O)c1c(Cl)cc(C(F)(F)F)cc1Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00221017 |
| 2,5-DIBROMO-1-METHYL-1H-IMIDAZOLE |
| 2,6-Dichloro-4-trifluoromethylbenzamide |