Benzomalvin C structure
|
Common Name | Benzomalvin C | ||
|---|---|---|---|---|
| CAS Number | 157047-98-8 | Molecular Weight | 395.41000 | |
| Density | 1.41g/cm3 | Boiling Point | 646.2ºC at 760mmHg | |
| Molecular Formula | C24H17N3O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 344.6ºC | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | 6'-methyl-3-phenylspiro[oxirane-2,7'-quinazolino[3,2-a][1,4]benzodiazepine]-5',13'-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 646.2ºC at 760mmHg |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.41000 |
| Flash Point | 344.6ºC |
| Exact Mass | 395.12700 |
| PSA | 67.73000 |
| LogP | 3.33350 |
| Vapour Pressure | 1.38E-16mmHg at 25°C |
| Index of Refraction | 1.736 |
| InChIKey | TWDKBDSVUUKABK-HYBUGGRVSA-N |
| SMILES | CN1C(=O)c2ccccc2-n2c(nc3ccccc3c2=O)C12OC2c1ccccc1 |
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H410 |
| Precautionary Statements | P273-P301 + P310-P501 |
| RIDADR | UN 2811 6.1 / PGIII |
|
Benzomalvins, new substance P inhibitors from a Penicillium sp.
J. Antibiot. 47(5) , 515-22, (1994) In the course of screening microbial broths for neurokinin receptor antagonists, a series of new benzodiazepines, benzomalvins A (1), B (2) and C (3), has been isolated from the culture broth of a fun... |
| Spiro[oxirane-2,7'(13'H)-quinazolino[3,2-a][1,4]benzodiazepine]-5',13'(6'H)-dione,6'-methyl-3-phenyl-,(2R,3S)-rel-(+)-(9CI) |
| Benzomalvin C |
| 6'-methyl-3-phenyl-13'h-spiro[oxirane-2,7'-quinazolino[3,2-a][1,4]benzodiazepine]-5',13'(6'h)-dione |