SNAP 5089 structure
|
Common Name | SNAP 5089 | ||
|---|---|---|---|---|
| CAS Number | 157066-76-7 | Molecular Weight | 645.18800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H41ClN4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SNAP 5089SNAP5089 is a subtype-selective α1A-adrenoceptor antagonist that displays > 600-fold selectivity over other adrenoceptors (Kivalues are 0.35, 220, 370, 540, 800 and 1200 nM for α1A, α1B, α2C, α1D, α2B and α2A subtypes respectively and 540 nM for L-type Ca2+ channels). |
| Name | 5-[[[3-(4,4-Diphenyl-1-piperidinyl)propyl]amino]carbonyl]-1,4-dihydro-2,6-dimethyl-4-(4-nitrophenyl)-3-pyridinecarboxylicacidmethylesterhydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C36H41ClN4O5 |
|---|---|
| Molecular Weight | 645.18800 |
| Exact Mass | 644.27700 |
| PSA | 116.49000 |
| LogP | 7.57380 |
| InChIKey | FIIXCJGBCCCOQQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)NCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)C1c1ccc([N+](=O)[O-])cc1 |
| snap 5089 |