Ethyl 4-(Boc-aminomethyl)benzoate structure
|
Common Name | Ethyl 4-(Boc-aminomethyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 157311-42-7 | Molecular Weight | 279.332 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 411.3±38.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.6±26.8 °C | |
| Name | ethyl 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 411.3±38.0 °C at 760 mmHg |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.332 |
| Flash Point | 202.6±26.8 °C |
| Exact Mass | 279.147064 |
| PSA | 68.12000 |
| LogP | 3.40 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | ZHBYJFBKZGWAFC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(CNC(=O)OC(C)(C)C)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethyl 4-(((tert-butoxycarbonyl)amino)methyl)benzoate |
| Benzoic acid, 4-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-, ethyl ester |
| Ethyl 4-(Boc-aminomethyl)benzoate |
| Ethyl 4-[({[(2-methyl-2-propanyl)oxy]carbonyl}amino)methyl]benzoate |