4-[(tert-Butoxycarbonylamino)methyl]benzoic acid structure
|
Common Name | 4-[(tert-Butoxycarbonylamino)methyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 33233-67-9 | Molecular Weight | 251.278 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 427.8±38.0 °C at 760 mmHg | |
| Molecular Formula | C13H17NO4 | Melting Point | 164-168 °C | |
| MSDS | Chinese USA | Flash Point | 212.6±26.8 °C | |
| Name | 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 427.8±38.0 °C at 760 mmHg |
| Melting Point | 164-168 °C |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.278 |
| Flash Point | 212.6±26.8 °C |
| Exact Mass | 251.115753 |
| PSA | 75.63000 |
| LogP | 2.57 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | LNKHBRDWRIIROP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C(=O)O)cc1 |
| Storage condition | Store at 0°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S22-S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| 4-carboxy-N-t-butoxycarbonylbenzylamine |
| MFCD00228182 |
| 4-[(Boc-amino)methyl]benzoic Acid |
| 4-t-butoxycarbonylaminomethylbenzoic acid |
| 4-[({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)methyl]benzoic acid |
| 4-(((tert-Butoxycarbonyl)amino)methyl)benzoic acid |
| Boc-4-Amb-OH |
| 4-{[(tert-butoxycarbonyl)amino]methyl}benzoic acid |
| BOC-(4-AMINOMETHYL)-BENZOIC ACID |
| Boc-Pamb-OH |
| 4-(TERT-BUTOXYCARBONYLAMINO-METHYL)-BENZOIC ACID |
| 4-[(tert-Butoxycarbonylamino)methyl]benzoic acid |
| Benzoic acid, 4-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]- |