tert-Butyl 3-((dimethylamino)methylene)-4-oxopiperidine-1-carboxylate structure
|
Common Name | tert-Butyl 3-((dimethylamino)methylene)-4-oxopiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 157327-41-8 | Molecular Weight | 254.325 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 357.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.2±27.9 °C | |
| Name | 1-Boc-3-[(Dimethylamino)methylene]-4-oxopiperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 357.9±42.0 °C at 760 mmHg |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.325 |
| Flash Point | 170.2±27.9 °C |
| Exact Mass | 254.163040 |
| PSA | 49.85000 |
| LogP | 1.49 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | YUSMZDVTEOAHDL-UHFFFAOYSA-N |
| SMILES | CN(C)C=C1CN(C(=O)OC(C)(C)C)CCC1=O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| Precursor 3 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Boc-3-((Dimethylamino)methylene)-4-oxopiperidine |
| 1-Piperidinecarboxylic acid, 3-[(dimethylamino)methylene]-4-oxo-, 1,1-dimethylethyl ester, (3Z)- |
| 3-Dimethylaminomethyl-but-3-en-2-on |
| tert-Butyl 3-[(dimethylamino)methylene]-4-oxotetrahydro-1(2H)-pyridinecarboxylate |
| N-tert-butoxycarbonyl-3-dimethylaminomethylene-4-piperidone |
| 3-Dimethylaminomethyl-3-buten-2-on |
| 2-Methyl-2-propanyl (3Z)-3-[(dimethylamino)methylene]-4-oxo-1-piperidinecarboxylate |
| 1-Piperidinecarboxylic acid, 3-[(dimethylamino)methylene]-4-oxo-, 1,1-dimethylethyl ester, (3E)- |
| 2-Methyl-2-propanyl (3E)-3-[(dimethylamino)methylene]-4-oxo-1-piperidinecarboxylate |
| 3-dimethylaminomethylen-4-oxo-piperidine-1-carboxylic acid tert-butyl ester |
| 2-dimethylaminomethyl-1-buten-3-one |
| tert-Butyl (3Z)-3-[(dimethylamino)methylene]-4-oxopiperidine-1-carboxylate |
| tert-Butyl 3-((dimethylamino)methylene)-4-oxopiperidine-1-carboxylate |
| 3-dimethylaminomethyl-but-3-en-2-one |
| 3-dimethylaminomethylene-1,1,1,5,5,5-hexafluoropentane-2,4-dione |
| 3-dimethylaminomethylene-4-oxopiperidine-1-carboxylic acid tert-butyl ester |