2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide structure
|
Common Name | 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 1574482-54-4 | Molecular Weight | 341.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H20FN3O2 |
|---|---|
| Molecular Weight | 341.4 |
| InChIKey | UURDJWYLNMHHDL-UHFFFAOYSA-N |
| SMILES | Cc1noc(C)c1CC(=O)NC1CCCc2c1[nH]c1ccc(F)cc21 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Primary qHTS assay for small molecule inhibitors of Inositol hexaphosphate kinase 1 (...
Source: NCGC
External Id: IP6K1-p1
|
|
Name: Primary qHTS assay for inhibitors of alpha-synuclein gene (SNCA) expression
Source: NCGC
External Id: SNCA-p-activity-luciferase
|
|
Name: Firefly luciferase inhibition profiling of diverse chemical library using quantitativ...
Source: NCGC
Target: N/A
External Id: CPF004
|
|
Name: Natriuretic polypeptide receptor (hNpr1) antagonism - Primary qHTS
Source: NCGC
Target: atrial natriuretic peptide receptor 1 [Homo sapiens]
External Id: hNprA-p1
|
|
Name: Cytotoxic Profiling in NIH 3T3 Cell Line of Diverse Libraries Using Quantitative High...
Source: NCGC
Target: N/A
External Id: CPF003
|
|
Name: Cytotoxic Profiling in HEK 293 Cell Line of Diverse Libraries Using Quantitative High...
Source: NCGC
Target: N/A
External Id: CPF002
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide? |
| A: SMILES notation of 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide is Cc1noc(C)c1CC(=O)NC1CCCc2c1[nH]c1ccc(F)cc21. |
| Q: What is the InChIKey of 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide? |
| A: InChIKey of 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide is UURDJWYLNMHHDL-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide? |
| A: CAS number of 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide is 1574482-54-4. |
| Q: What is the molecular formula of 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide? |
| A: Molecular formula of 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide is C19H20FN3O2. |
| Q: What is the Chinese name of 1574482-54-4? |
| A: Chinese name of 1574482-54-4 is 1574482-54-4. |
| Q: What is the English name of 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide? |
| A: The English name of 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide is 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide. |
| Q: What is the molecular weight of 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide? |
| A: Molecular weight of 2-(3,5-dimethyl-4-isoxazolyl)-N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)acetamide is 341.4. |