Dioctyl 2-hydroxysuccinate structure
|
Common Name | Dioctyl 2-hydroxysuccinate | ||
|---|---|---|---|---|
| CAS Number | 15763-02-7 | Molecular Weight | 358.51300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H38O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dioctyl 2-hydroxybutanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H38O5 |
|---|---|
| Molecular Weight | 358.51300 |
| Exact Mass | 358.27200 |
| PSA | 72.83000 |
| LogP | 4.54480 |
| InChIKey | CNHQWLUGXFIDAT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)CC(O)C(=O)OCCCCCCCC |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Malic acid,dioctyl ester (7CI,8CI) |
| Aepfelsaeure-dioctylester |
| Butanedioic acid,2-hydroxy-,1,4-dioctyl ester |
| Butanedioicacid,hydroxy-,dioctyl ester (9CI) |
| Dioctyl malate |