Methyl 6-nitro-1H-indole-2-carboxylate structure
|
Common Name | Methyl 6-nitro-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 157649-56-4 | Molecular Weight | 220.182 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 424.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.4±23.2 °C | |
| Name | methyl 5-nitro-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 424.2±25.0 °C at 760 mmHg |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.182 |
| Flash Point | 210.4±23.2 °C |
| Exact Mass | 220.048401 |
| PSA | 87.91000 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | PTZVWKVAXNDAIR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2cc([N+](=O)[O-])ccc2[nH]1 |
| HS Code | 2933990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-2-carboxylic acid, 5-nitro-, methyl ester |
| Methyl 5-nitro-1H-indole-2-carboxylate |
| 5-nitro-1H-indole-2-carboxylic acid methyl ester |
| methyl 5-nitroindole-2-carboxylate |
| 1H-Indole-2-carboxylic acid, 6-nitro-, methyl ester |
| 5-Nitro-2-indolecarboxylic acid |
| Methyl 6-nitro-1H-indole-2-carboxylate |
| Y7663 |