1H-Indole-2-carboxylic acid, 1-acetyl-2,3-dihydro-, methyl ester structure
|
Common Name | 1H-Indole-2-carboxylic acid, 1-acetyl-2,3-dihydro-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 110659-07-9 | Molecular Weight | 219.23700 | |
| Density | 1.228g/cm3 | Boiling Point | 403.7ºC at 760 mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198ºC | |
| Name | 1H-Indole-2-carboxylic acid, 1-acetyl-2,3-dihydro-, methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 403.7ºC at 760 mmHg |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.23700 |
| Flash Point | 198ºC |
| Exact Mass | 219.09000 |
| PSA | 46.61000 |
| LogP | 1.20220 |
| Vapour Pressure | 9.96E-07mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | OLNXWFGVNGEHRF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1Cc2ccccc2N1C(C)=O |
|
~92%
1H-Indole-2-... CAS#:110659-07-9 |
| Literature: Dolle, Roland E.; Chu, Guo-Hua Patent: US2005/54630 A1, 2005 ; Location in patent: Page/Page column 49 ; US 20050054630 A1 |
|
~89%
1H-Indole-2-... CAS#:110659-07-9 |
| Literature: Kuwano, Ryoichi; Sato, Koji; Kurokawa, Takashi; Karube, Daisuke; Ito, Yoshihiko Journal of the American Chemical Society, 2000 , vol. 122, # 31 p. 7614 - 7615 |
|
~%
1H-Indole-2-... CAS#:110659-07-9 |
| Literature: Kuwano, Ryoichi; Sato, Koji; Kurokawa, Takashi; Karube, Daisuke; Ito, Yoshihiko Journal of the American Chemical Society, 2000 , vol. 122, # 31 p. 7614 - 7615 |
|
~%
1H-Indole-2-... CAS#:110659-07-9 |
| Literature: Lavrenov, Sergei N.; Lakatosh, Sergei A.; Lysenkova, Ludmila N.; Korolev, Alexander M.; Preobrazhenskaya, Maria N. Synthesis, 2002 , # 3 p. 320 - 322 |
| Precursor 5 | |
|---|---|
| DownStream 7 | |
| 6-methoxycarbonyl-N-acetylindole |
| N-acetyl-indoline-2-carboxylic acid methyl ester |
| methyl N-acetylindole-6-carboxylate |
| 1-acetyl-6-methoxycarbonylindole |
| methyl 1-acetylindoline-2-carboxylate |
| methyl N-acetylindoline-2-carboxylate |