CNP-AFU structure
|
Common Name | CNP-AFU | ||
|---|---|---|---|---|
| CAS Number | 157843-41-9 | Molecular Weight | 319.695 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 527.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H14ClNO7 | Melting Point | 125-129ºC | |
| MSDS | N/A | Flash Point | 272.7±30.1 °C | |
Use of CNP-AFUCNP-AFU (2-Chloro-4-nitrophenyl α-L-fucopyranoside) is a substrate for alpha-L-fucosidase(AFU). |
| Name | 2-Chloro-4-nitrophenyl-alpha-L-fucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | CNP-AFU (2-Chloro-4-nitrophenyl α-L-fucopyranoside) is a substrate for alpha-L-fucosidase(AFU). |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 527.3±50.0 °C at 760 mmHg |
| Melting Point | 125-129ºC |
| Molecular Formula | C12H14ClNO7 |
| Molecular Weight | 319.695 |
| Flash Point | 272.7±30.1 °C |
| Exact Mass | 319.045868 |
| PSA | 124.97000 |
| LogP | 1.81 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | QURSGHQPKUXLAD-MOBXTKCLSA-N |
| SMILES | CC1OC(Oc2ccc([N+](=O)[O-])cc2Cl)C(O)C(O)C1O |
| Storage condition | -20°C |
| Hazard Codes | F+ |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2S,3S,4R,5S,6S)-2-(2-chloro-4-nitrophenoxy)-6-methyloxane-3,4,5-triol |
| 2-Chloro-4-nitrophenyl 6-deoxy-α-L-galactopyranoside |
| α-L-Galactopyranoside, 2-chloro-4-nitrophenyl 6-deoxy- |
| CNP-AFU |