(2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride structure
|
Common Name | (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1581252-96-1 | Molecular Weight | 268.78 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H21ClN2O |
|---|---|
| Molecular Weight | 268.78 |
| InChIKey | UITSNHGZIKHKBE-UHFFFAOYSA-N |
| SMILES | CC(C)CC(N)C(=O)N1CCc2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1581252-96-1? |
| A: Chinese name of 1581252-96-1 is 1581252-96-1. |
| Q: What is the InChIKey of (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride? |
| A: InChIKey of (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride is UITSNHGZIKHKBE-UHFFFAOYSA-N. |
| Q: What is the English name of (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride? |
| A: The English name of (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride is (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride. |
| Q: What is the CAS number of (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride? |
| A: CAS number of (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride is 1581252-96-1. |
| Q: What is the SMILES notation of (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride? |
| A: SMILES notation of (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride is CC(C)CC(N)C(=O)N1CCc2ccccc21. |
| Q: What is the molecular formula of (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride? |
| A: Molecular formula of (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride is C14H21ClN2O. |
| Q: What is the molecular weight of (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride? |
| A: Molecular weight of (2S)-2-amino-1-(2,3-dihydro-1H-indol-1-yl)-4-methylpentan-1-one hydrochloride is 268.78. |