2,4-Pentanedione,3-[(4-methylphenyl)methylene]- structure
|
Common Name | 2,4-Pentanedione,3-[(4-methylphenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 15818-09-4 | Molecular Weight | 202.24900 | |
| Density | 1.063g/cm3 | Boiling Point | 380.2ºC at 760mmHg | |
| Molecular Formula | C13H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.6ºC | |
| Name | 3-[(4-methylphenyl)methylidene]pentane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.063g/cm3 |
|---|---|
| Boiling Point | 380.2ºC at 760mmHg |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.24900 |
| Flash Point | 142.6ºC |
| Exact Mass | 202.09900 |
| PSA | 34.14000 |
| LogP | 2.55640 |
| Vapour Pressure | 5.56E-06mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | MWWKEDDFUHGKIP-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=Cc1ccc(C)cc1)C(C)=O |
|
~91%
2,4-Pentanedion... CAS#:15818-09-4 |
| Literature: Li, Zhong-Xian; Liu, Xiao-Pei; Qiu, Zhen; Xu, Dan; Yu, Xue-Jun Journal of Chemical Research, 2011 , vol. 35, # 1 p. 35 - 36 |
|
~73%
2,4-Pentanedion... CAS#:15818-09-4 |
| Literature: Attanasi, Orazio; Filippone, Paolino; Mei, Amedeo Synthetic Communications, 1983 , vol. 13, # 14 p. 1203 - 1208 |
| 4'-methyl-3-benzylidene-2,4-pentanedione |
| 3-(4-Methyl-benzyliden)-pentan-2,4-dion |
| 3-(4-methyl-benzylidene)-pentane-2,4-dione |
| 2-acetyl-1-methyl-3-(4-methylphenyl)propenone |