bis(1,10-phenanthroline)copper(2+) ion structure
|
Common Name | bis(1,10-phenanthroline)copper(2+) ion | ||
|---|---|---|---|---|
| CAS Number | 15823-71-9 | Molecular Weight | 423.95700 | |
| Density | N/A | Boiling Point | 365.1ºC at 760 mmHg | |
| Molecular Formula | C24H16CuN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.8ºC | |
| Name | copper,1,10-phenanthroline |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 365.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C24H16CuN4 |
| Molecular Weight | 423.95700 |
| Flash Point | 164.8ºC |
| Exact Mass | 423.06700 |
| PSA | 51.56000 |
| LogP | 5.56350 |
| Vapour Pressure | 3.38E-05mmHg at 25°C |
| InChIKey | YXGZTNUNHBXFAX-UHFFFAOYSA-N |
| SMILES | [Cu+2].c1cnc2c(c1)ccc1cccnc12.c1cnc2c(c1)ccc1cccnc12 |
|
~%
bis(1,10-phenan... CAS#:15823-71-9 |
| Literature: Johnson, G. R. Alastair; Nazhat, Najdat B. Journal of the American Chemical Society, 1987 , vol. 109, # 7 p. 1990 - 1994 |
|
~%
bis(1,10-phenan... CAS#:15823-71-9 |
| Literature: Goldstein, Sara; Czapski, Gidon; Eldik, Rudi van; Cohen, Haim; Meyerstein, Dan Journal of Physical Chemistry, 1991 , vol. 95, # 3 p. 1282 - 1285 |
|
~%
bis(1,10-phenan... CAS#:15823-71-9 |
| Literature: Araujo, Marco A. de; Hodges, H. Leslie Inorganic Chemistry, 1982 , vol. 21, p. 3167 - 3172 |
|
~%
bis(1,10-phenan... CAS#:15823-71-9 |
| Literature: Franc, Gregory; Jutand, Anny Dalton Transactions, 2010 , vol. 39, # 34 p. 7873 - 7875 |
| Copper / 1,10-phenanthroline complex |
| bis(1,10-phenanthroline)copper(II) |
| Cu(Phen)2 |
| Copper(II)-1,10-phenanthroline complex |
| Copper(II)-phenanthroline complex |
| bis(1,10-phenanthroline)copper(2+) |
| Copper 1,10-phenanthroline |
| (o-Phenanthroline) cupric |
| Copper(2+)-1,10-phenanthroline complex |
| Cu(1,10-phenanthroline)2(2+) |
| Bis(1,10-phenanthroline)copper(2+) ion |
| Cu(OP)2 |
| bis(1,10-phenanthroline)copper(II)(2+) |
| Cupric di(1,10-phenanthroline) |