Fentrazamide structure
|
Common Name | Fentrazamide | ||
|---|---|---|---|---|
| CAS Number | 158237-07-1 | Molecular Weight | 349.81500 | |
| Density | 1.4 g/cm3 | Boiling Point | 434.4ºC at 760 mmHg | |
| Molecular Formula | C16H20ClN5O2 | Melting Point | 79ºC | |
| MSDS | Chinese USA | Flash Point | 216.5ºC | |
| Symbol |
GHS09 |
Signal Word | Warning | |
Use of FentrazamideFentrazamide is a herbicide. |
| Name | fentrazamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4 g/cm3 |
|---|---|
| Boiling Point | 434.4ºC at 760 mmHg |
| Melting Point | 79ºC |
| Molecular Formula | C16H20ClN5O2 |
| Molecular Weight | 349.81500 |
| Flash Point | 216.5ºC |
| Exact Mass | 349.13100 |
| PSA | 73.02000 |
| LogP | 2.70510 |
| Vapour Pressure | 9.54E-08mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | LLQPHQFNMLZJMP-UHFFFAOYSA-N |
| SMILES | CCN(C(=O)n1nnn(-c2ccccc2Cl)c1=O)C1CCCCC1 |
| Storage condition | 0-6°C |
|
~%
Fentrazamide CAS#:158237-07-1 |
| Literature: Bayer Aktiengesellschaft Patent: US5686392 A1, 1997 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(2-Chlorophenyl)-N-cyclohexyl-N-ethyl-4,5-dihydro-5-oxo-1H-tetrazole-1-carboxamide |
| Fentrazamide |
| BAY-YRC 2388 |
| Bai Tian Jing |
| 4-(2-chlorophenyl)-N-cyclohexyl-N-ethyl-5-oxo-4,5-dihydro-1H-tetrazole-1-carboxamide |
| 4-(2-chlorophenyl)-N-cyclohexyl-N-ethyl-5-oxotetrazole-1-carboxamide |
| 4-(2-chlorophenyl)-N-cyclohexyl-N-ethyl-4,5-dihydro-5-oxo-1H-tetrazole-1-carboxamide |
| Innova |