5-Fluoroisophthalic Acid structure
|
Common Name | 5-Fluoroisophthalic Acid | ||
|---|---|---|---|---|
| CAS Number | 1583-66-0 | Molecular Weight | 184.12100 | |
| Density | 1.551g/cm3 | Boiling Point | 407.7ºC at 760mmHg | |
| Molecular Formula | C8H5FO4 | Melting Point | 295-297ºC | |
| MSDS | N/A | Flash Point | 200.4ºC | |
| Name | 5-Fluoroisophthalic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.551g/cm3 |
|---|---|
| Boiling Point | 407.7ºC at 760mmHg |
| Melting Point | 295-297ºC |
| Molecular Formula | C8H5FO4 |
| Molecular Weight | 184.12100 |
| Flash Point | 200.4ºC |
| Exact Mass | 184.01700 |
| PSA | 74.60000 |
| LogP | 1.22210 |
| Vapour Pressure | 2.23E-07mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | AUIOTTUHAZONIC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(F)cc(C(=O)O)c1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2917399090 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 5-Fluoroisophthalic acid |
| 5-fluorobenzene-1,3-dicarboxylic acid |