Catalpalactone structure
|
Common Name | Catalpalactone | ||
|---|---|---|---|---|
| CAS Number | 1585-68-8 | Molecular Weight | 258.269 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 467.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.2±27.1 °C | |
Use of CatalpalactoneCatalpalactone has anti-inflammatory effect. Catalpalactone inhibits LPS-induced NO production and iNOS expression in RAW264.7 cells, and also inhibits IRF3, NF-κB, and IFN-β/STAT-1 activation. Catalpalactone also inhibits dopamine biosynthesis by reducing tyrosine hydroxylase (TH) and aromatic-l-amino acid decarboxylase (AADC) activities[1][2]. |
| Name | 3-(2,2-dimethyl-6-oxo-3H-pyran-5-yl)-3H-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | Catalpalactone has anti-inflammatory effect. Catalpalactone inhibits LPS-induced NO production and iNOS expression in RAW264.7 cells, and also inhibits IRF3, NF-κB, and IFN-β/STAT-1 activation. Catalpalactone also inhibits dopamine biosynthesis by reducing tyrosine hydroxylase (TH) and aromatic-l-amino acid decarboxylase (AADC) activities[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 467.1±45.0 °C at 760 mmHg |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.269 |
| Flash Point | 245.2±27.1 °C |
| Exact Mass | 258.089203 |
| PSA | 52.60000 |
| LogP | 2.05 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | GFYSRANGENPXDF-UHFFFAOYSA-N |
| SMILES | CC1(C)CC=C(C2OC(=O)c3ccccc32)C(=O)O1 |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| 3-(5,6-Dihydro-6,6-dimethyl-2-oxo-2H-pyran-3-yl)-1(3H)-isobenzofuranone |
| 1(3H)-Isobenzofuranone, 3-(5,6-dihydro-6,6-dimethyl-2-oxo-2H-pyran-3-yl)- |
| Catalpalactone |
| 3-(6,6-Dimethyl-2-oxo-5,6-dihydro-2H-pyran-3-yl)-2-benzofuran-1(3H)-one |