4-Pyridinecarboxamide,N-(1-methyl-2-phenylethyl)- structure
|
Common Name | 4-Pyridinecarboxamide,N-(1-methyl-2-phenylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 15855-02-4 | Molecular Weight | 240.30000 | |
| Density | 1.106g/cm3 | Boiling Point | 465.9ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.6ºC | |
| Name | N-(1-phenylpropan-2-yl)pyridine-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 465.9ºC at 760 mmHg |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30000 |
| Flash Point | 235.6ºC |
| Exact Mass | 240.12600 |
| PSA | 41.99000 |
| LogP | 2.83350 |
| Vapour Pressure | 7.4E-09mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | NABUKNINVWXMID-UHFFFAOYSA-N |
| SMILES | CC(Cc1ccccc1)NC(=O)c1ccncc1 |
|
~%
4-Pyridinecarbo... CAS#:15855-02-4 |
| Literature: Lepetit S.p.A. Patent: US2858317 , 1954 ; |
|
~%
4-Pyridinecarbo... CAS#:15855-02-4 |
| Literature: Hey; Williams Journal of the Chemical Society, 1951 , p. 1527,1529 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (+-)-isonicotinic acid-(1-methyl-2-phenyl-ethylamide) |
| (+-)-Isonicotinsaeure-(1-methyl-2-phenyl-aethylamid) |