2-Methoxy-4-nitrobiphenyl structure
|
Common Name | 2-Methoxy-4-nitrobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 15862-01-8 | Molecular Weight | 229.231 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 349.6±22.0 °C at 760 mmHg | |
| Molecular Formula | C13H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.1±24.3 °C | |
| Name | 2-methoxy-4-nitro-1-phenylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 349.6±22.0 °C at 760 mmHg |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.231 |
| Flash Point | 152.1±24.3 °C |
| Exact Mass | 229.073898 |
| PSA | 55.05000 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | ZWZJLJMULXIMLU-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccccc1 |
|
~%
2-Methoxy-4-nit... CAS#:15862-01-8 |
| Literature: NOVARTIS AG; NOVARTIS PHARMA GMBH Patent: WO2003/99771 A2, 2003 ; Location in patent: Page 70 ; WO 03/099771 A2 |
|
~%
2-Methoxy-4-nit... CAS#:15862-01-8 |
| Literature: Vink,J.A.J. et al. Tetrahedron, 1972 , vol. 28, p. 5081 - 5087 |
|
~%
2-Methoxy-4-nit... CAS#:15862-01-8 |
| Literature: Ahmad,Y. et al. Canadian Journal of Chemistry, 1967 , vol. 45, p. 1539 - 1542 |
| 2-Methoxy-4-nitrobiphenyl |
| Methyl 4-nitrobiphenyl-2-yl ether |
| 1,1'-Biphenyl, 2-methoxy-4-nitro- |
| 1,1'-Biphenyl,2-methoxy-4-nitro |
| 5-nitro 2-phenyl anisole |
| 4-nitro-2-methoxybiphenyle |