Thiourea,N-cyclohexyl-N'-(4-methylphenyl)- structure
|
Common Name | Thiourea,N-cyclohexyl-N'-(4-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 15863-19-1 | Molecular Weight | 248.38700 | |
| Density | 1.11g/cm3 | Boiling Point | 361.6ºC at 760 mmHg | |
| Molecular Formula | C14H20N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.5ºC | |
| Name | 1-cyclohexyl-3-(4-methylphenyl)thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 361.6ºC at 760 mmHg |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.38700 |
| Flash Point | 172.5ºC |
| Exact Mass | 248.13500 |
| PSA | 56.15000 |
| LogP | 4.07800 |
| Vapour Pressure | 2.05E-05mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | CFLODRBMZSPZIU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=S)NC2CCCCC2)cc1 |
|
~83%
Thiourea,N-cycl... CAS#:15863-19-1 |
| Literature: Saad, Hosam Phosphorus, Sulfur and Silicon and the Related Elements, 2006 , vol. 181, # 7 p. 1557 - 1567 |
| 1-cyclohexyl-3-p-tolyl-thiourea |
| N-cyclohexyl-N'-p-tolylthiourea |