Thiourea,N,N'-bis(4-methylphenyl)- structure
|
Common Name | Thiourea,N,N'-bis(4-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 621-01-2 | Molecular Weight | 256.36600 | |
| Density | 1.219g/cm3 | Boiling Point | 377.7ºC at 760 mmHg | |
| Molecular Formula | C15H16N2S | Melting Point | 182-184 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 182.2ºC | |
| Name | 4,4'-dimethylthiocarbanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 377.7ºC at 760 mmHg |
| Melting Point | 182-184 °C(lit.) |
| Molecular Formula | C15H16N2S |
| Molecular Weight | 256.36600 |
| Flash Point | 182.2ºC |
| Exact Mass | 256.10300 |
| PSA | 56.15000 |
| LogP | 4.25830 |
| Index of Refraction | 1.707 |
| InChIKey | ULNVBRUIKLYGDF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=S)Nc2ccc(C)cc2)cc1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| RTECS | FE0875000 |
| HS Code | 2930909090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 210-665-0 |
| 4,4'-Dimethylthiocarbanilide |
| 1,3-bis(4-methylphenyl)thiourea |
| MFCD00008541 |