3-Methoxy-2-nitrobenzoyl chloride structure
|
Common Name | 3-Methoxy-2-nitrobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 15865-57-3 | Molecular Weight | 215.59100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Methoxy-2-nitrobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6ClNO4 |
|---|---|
| Molecular Weight | 215.59100 |
| Exact Mass | 214.99900 |
| PSA | 72.12000 |
| LogP | 2.50560 |
| InChIKey | URDXWTRRYHFFQK-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)Cl)c1[N+](=O)[O-] |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Methoxy-2-nitro-benzoylchlorid |
| 2-Nitro-3-methoxy-benzoesaeure-chlorid |
| 2-nitro-3-methoxybenzoyl chloride |
| 3-methoxy-2-nitro benzoyl chloride |
| 3-methoxy-2-nitrobenzoic acid chloride |