5-methoxy-2-nitrobenzoyl chloride structure
|
Common Name | 5-methoxy-2-nitrobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 63932-00-3 | Molecular Weight | 215.59100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methoxy-2-nitrobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6ClNO4 |
|---|---|
| Molecular Weight | 215.59100 |
| Exact Mass | 214.99900 |
| PSA | 72.12000 |
| LogP | 2.50560 |
| InChIKey | LJHNJIGHMDBSEH-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c(C(=O)Cl)c1 |
|
~%
5-methoxy-2-nit... CAS#:63932-00-3 |
| Literature: Makino; Takahashi Journal of the American Chemical Society, 1954 , vol. 76, p. 4994 |
|
~%
5-methoxy-2-nit... CAS#:63932-00-3 |
| Literature: Spirogen Limited Patent: EP1193270 A2, 2002 ; Location in patent: Page 64, 118 ; |
| Benzoyl chloride,5-methoxy-2-nitro |