TERT-BUTYLN-[2-(TOSYLOXY)ETHYL]CARBAMATE structure
|
Common Name | TERT-BUTYLN-[2-(TOSYLOXY)ETHYL]CARBAMATE | ||
|---|---|---|---|---|
| CAS Number | 158690-56-3 | Molecular Weight | 315.38500 | |
| Density | 1.189g/cm3 | Boiling Point | 461.949ºC at 760 mmHg | |
| Molecular Formula | C14H21NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.179ºC | |
| Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 461.949ºC at 760 mmHg |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.38500 |
| Flash Point | 233.179ºC |
| Exact Mass | 315.11400 |
| PSA | 90.08000 |
| LogP | 3.69670 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | OWNIGLWHXOENAA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCNC(=O)OC(C)(C)C)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2924299090 |
|---|
|
~94%
TERT-BUTYLN-[2-... CAS#:158690-56-3 |
| Literature: McGouran, Joanna F.; Kramer, Holger B.; MacKeen, Mukram M.; Di Gleria, Katalin; Altun, Mikael; Kessler, Benedikt M. Organic and Biomolecular Chemistry, 2012 , vol. 10, # 17 p. 3379 - 3383 |
|
~%
TERT-BUTYLN-[2-... CAS#:158690-56-3 |
| Literature: Journal of Labelled Compounds and Radiopharmaceuticals, , vol. 45, # 2 p. 115 - 137 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| toluene-4-sulfonic acid 2-tert-butoxycarbonylamino-ethyl ester |
| O-tosyl-N-Boc-ethanolamine |
| 2-((tert-butoxycarbonyl)amino)ethyl 4-methylbenzenesulfonate |
| 2-(BOC-amino)ethyl tosylate |
| [2-(tert-butyloxycarbonylamino)ethyl] toluene-4-sulphonate |
| QC-2227 |
| N-t-BOC-[2-(p-toluenesulfonyloxy)ethylamine] |
| Tert-butyl n-[2-(tosyloxy)ethyl]carbamate |
| 2-tert-butoxycarbonylaminoethyl 4-toluenesulfonate |
| AmbkkkkK110 |