2-Boc-Aminobenzaldehyde structure
|
Common Name | 2-Boc-Aminobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 74965-38-1 | Molecular Weight | 221.25200 | |
| Density | 1.163g/cm3 | Boiling Point | 291.7ºC at 760 mmHg | |
| Molecular Formula | C12H15NO3 | Melting Point | 57-61 °C | |
| MSDS | Chinese USA | Flash Point | 130.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tert-butyl N-(2-formylphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 291.7ºC at 760 mmHg |
| Melting Point | 57-61 °C |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25200 |
| Flash Point | 130.2ºC |
| Exact Mass | 221.10500 |
| PSA | 55.40000 |
| LogP | 2.91910 |
| Index of Refraction | 1.575 |
| InChIKey | DHALMIBUKCNMLD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1C=O |
| Storage condition | 2-8°C |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-tert-butoxycarbonyl-2-aminobenzaldehyde |
| tert-ButylN-(2-formylphenyl)carbamate |
| 1,1-Dimethylethyl2-formylphenylcarbamate |
| N-tert-butoxycarbonylamino benzaldehyde |
| 2-Boc-aminobenzaldehyde |
| 2-amino-N-tert-butoxycarbonylbenzaldehyde |
| 2-(tert-butyloxycarbonyl)aminobenzaldehyde |
| Carbamic acid,(2-formylphenyl)-,1,1-dimethylethyl ester |
| Carbamicacid,(2-formylphenyl)-,1,1-dimethylethyl ester (9CI) |
| tert-Butyl (2-formylphenyl)carbamate |
| (2-formyl-phenyl)-carbamic acid tert-butyl ester |
| (2-Formylphenyl)carbamic acid 1,1-dimethylethyl ester |