dibutylmalate structure
|
Common Name | dibutylmalate | ||
|---|---|---|---|---|
| CAS Number | 1587-18-4 | Molecular Weight | 246.30 | |
| Density | 1.064g/cm3 | Boiling Point | 344.3ºC at 760 mmHg | |
| Molecular Formula | C12H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.3ºC | |
| Name | dibutylmalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.064g/cm3 |
|---|---|
| Boiling Point | 344.3ºC at 760 mmHg |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 |
| Flash Point | 121.3ºC |
| Exact Mass | 246.14672380 |
| PSA | 89.49000 |
| Vapour Pressure | 4.24E-06mmHg at 25°C |
| Index of Refraction | 1.454 |
| InChIKey | PDSCSYLDRHAHOX-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CC(C(=O)OCCCC)O |
| HS Code | 2918199090 |
|---|
|
~%
dibutylmalate CAS#:1587-18-4 |
| Literature: Crompton Corporation Patent: US7696136 B2, 2010 ; |
|
~%
Detail
Learn More
|
| Literature: Kajjout, Mohammed; Hebting, Yanek; Albrecht, Pierre; Adam, Pierre Chemistry and Biodiversity, 2012 , vol. 9, # 4 p. 714 - 726 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Hydroxybutanedioic acid dibutyl ester |
| dibutyl ester,dibutyl malate |
| hydroxy-butanedioic acid |
| malic acid dibutyl ester |
| di-n-butyl malate |
| Aepfelsaeure-dibutylester |
| Dibutyl-DL-malat |