6-Hydroxy-7-(isopentenyloxy)-2H-1-benzopyran-2-one structure
|
Common Name | 6-Hydroxy-7-(isopentenyloxy)-2H-1-benzopyran-2-one | ||
|---|---|---|---|---|
| CAS Number | 15870-91-4 | Molecular Weight | 246.26 | |
| Density | 1.237g/cm3 | Boiling Point | 451.6ºC at 760 mmHg | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.9ºC | |
Use of 6-Hydroxy-7-(isopentenyloxy)-2H-1-benzopyran-2-onePrenyletin is a natural product, that can be isolated from the roots of Ptaeroxylon obliquum Radlk. (Rutaceae). Prenyletin shows anti-oxidative stress activity[1]. |
| Name | 6-Hydroxy-7-[(3-methyl-2-buten-1-yl)oxy]-2H-chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Prenyletin is a natural product, that can be isolated from the roots of Ptaeroxylon obliquum Radlk. (Rutaceae). Prenyletin shows anti-oxidative stress activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 451.6ºC at 760 mmHg |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 |
| Flash Point | 173.9ºC |
| Exact Mass | 246.08900 |
| PSA | 59.67000 |
| LogP | 2.84360 |
| Vapour Pressure | 8.97E-09mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | AWEFUQDNSBBNCR-UHFFFAOYSA-N |
| SMILES | CC(C)=CCOc1cc2oc(=O)ccc2cc1O |
| HS Code | 2932209090 |
|---|
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-hydroxy-7-prenyloxycoumarin |
| 6-hydroxy-7-[(3-methyl-2-buten-1-yl)oxy]-2H-1-benzopyran-2-one |
| 7-O-(3,3-Dimethylallyl)-aesculetin |
| (E)-1-hydroxy-1-phenylhex-4-en-3-one |
| 4-Hexen-3-one,1-hydroxy-1-phenyl-,(4E) |
| 6-hydroxy-7-(3,3-dimethylallyloxy)coumarin |
| 6-hydroxy-6-phenyl-2-hexen-4-one |