Dalbergin structure
|
Common Name | Dalbergin | ||
|---|---|---|---|---|
| CAS Number | 482-83-7 | Molecular Weight | 268.264 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 489.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H12O4 | Melting Point | 210ºC | |
| MSDS | N/A | Flash Point | 187.5±22.2 °C | |
Use of DalberginDalbergin is a composition of the extract from the Dalbergia Sissoo Linn. knot wood. Dalbergin demonstrats notable antioxidant ability[1]. |
| Name | 6-hydroxy-7-methoxy-4-phenylchromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Dalbergin is a composition of the extract from the Dalbergia Sissoo Linn. knot wood. Dalbergin demonstrats notable antioxidant ability[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 489.0±45.0 °C at 760 mmHg |
| Melting Point | 210ºC |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.264 |
| Flash Point | 187.5±22.2 °C |
| Exact Mass | 268.073547 |
| PSA | 59.67000 |
| LogP | 3.34 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | AZELSOYQOIUPBZ-UHFFFAOYSA-N |
| SMILES | COc1cc2oc(=O)cc(-c3ccccc3)c2cc1O |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36-24/25 |
| HS Code | 29329990 |
| 6-hydroxy-7-methoxyl-4-phenylcoumarin |
| 2H-1-Benzopyran-2-one, 6-hydroxy-7-methoxy-4-phenyl- |
| 6-Hydroxy-7-methoxy-4-phenyl-2H-chromen-2-one |
| 6-hydroxy-7-methoxy-4-phenylcoumarin |
| 6-hydroxy-7-methoxy-4-phenyl-chromen-2-one |
| 6-hydroxy-7-methoxy-4-phenyl-2H-1-benzopyran-2-one |
| MFCD00075721 |
| Dalbergin |
| DALBERGIONE |