Omeprazole Sulfone N-Oxide structure
|
Common Name | Omeprazole Sulfone N-Oxide | ||
|---|---|---|---|---|
| CAS Number | 158812-85-2 | Molecular Weight | 377.415 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 694.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C17H19N3O5S | Melting Point | 200-202°C | |
| MSDS | Chinese USA | Flash Point | 373.7±34.3 °C | |
| Name | 6-methoxy-2-[(4-methoxy-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methylsulfonyl]-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 694.4±65.0 °C at 760 mmHg |
| Melting Point | 200-202°C |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.415 |
| Flash Point | 373.7±34.3 °C |
| Exact Mass | 377.104553 |
| PSA | 115.12000 |
| LogP | 1.81 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | ZBGMHRIYIGAEGJ-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(S(=O)(=O)Cc3c(C)c(OC)c(C)c[n+]3[O-])[nH]c2c1 |
| Storage condition | Refrigerator |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Omeprazole impurity I [EP] |
| 1H-Benzimidazole, 5-methoxy-2-[[(4-methoxy-3,5-dimethyl-1-oxido-2-pyridinyl)methyl]sulfonyl]- |
| 5-Methoxy-2-{[(4-methoxy-3,5-dimethyl-1-oxido-2-pyridinyl)methyl]sulfonyl}-1H-benzimidazole |
| UNII-3GZ7SI3024 |
| Omeprazole Sulfone N-Oxide |
| 1H-Benzimidazole,6-methoxy-2-(((4-methoxy-3,5-dimethyl-1-oxido-2-pyridinyl)methyl)sulfonyl) |
| BEN504 |
| Omeprazole related compound I |
| Esomeprazole Impurity 7 |