(4-ethoxy-2-hydroxyphenyl)-phenylmethanone structure
|
Common Name | (4-ethoxy-2-hydroxyphenyl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 15889-70-0 | Molecular Weight | 242.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (4-ethoxy-2-hydroxyphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O3 |
|---|---|
| Molecular Weight | 242.27000 |
| Exact Mass | 242.09400 |
| PSA | 46.53000 |
| LogP | 3.02190 |
| InChIKey | JAFUHGPESJSRJX-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(=O)c2ccccc2)c(O)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Ethoxy-2-hydroxybenzophenone |
| 2-Hydroxy-4-aethoxybenzophenon |
| (4-ethoxy-2-hydroxyphenyl)phenyl methanone |
| 2-Hydroxy-4-ethoxy-benzophenon |
| MFCD04039906 |