xylose 1-phosphate structure
|
Common Name | xylose 1-phosphate | ||
|---|---|---|---|---|
| CAS Number | 15892-22-5 | Molecular Weight | 230.11000 | |
| Density | 1.88g/cm3 | Boiling Point | 541.6ºC at 760mmHg | |
| Molecular Formula | C5H11O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.4ºC | |
| Name | [(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.88g/cm3 |
|---|---|
| Boiling Point | 541.6ºC at 760mmHg |
| Molecular Formula | C5H11O8P |
| Molecular Weight | 230.11000 |
| Flash Point | 281.4ºC |
| Exact Mass | 230.01900 |
| PSA | 146.49000 |
| Vapour Pressure | 5.46E-14mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | ILXHFXFPPZGENN-IOVATXLUSA-N |
| SMILES | O=P(O)(O)OC1OCC(O)C(O)C1O |
|
~%
xylose 1-phosphate CAS#:15892-22-5 |
| Literature: Wright; Khorana Journal of the American Chemical Society, 1956 , vol. 78, p. 811,814, 815 |
| Xylose 1-phosphate |