Galactose 1-phosphate-13C potassium structure
|
Common Name | Galactose 1-phosphate-13C potassium | ||
|---|---|---|---|---|
| CAS Number | 478518-78-4 | Molecular Weight | 337.30900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H11K2O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Galactose 1-phosphate-13C potassiumGalactose 1-phosphate-13C potassium is the 13C labeled Galactose 1-phosphate Potassium salt. Galactose 1-phosphate Potassium salt is is an intermediate in the galactose metabolism and nucleotide sug[1][2]. |
| Name | α-D-[1-13C]GALACTOPYRANOSYL 1-PHOSPHATE DIPOTASSIUM SALT |
|---|
| Description | Galactose 1-phosphate-13C potassium is the 13C labeled Galactose 1-phosphate Potassium salt. Galactose 1-phosphate Potassium salt is is an intermediate in the galactose metabolism and nucleotide sug[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C6H11K2O9P |
|---|---|
| Molecular Weight | 337.30900 |
| Exact Mass | 336.94500 |
| PSA | 172.38000 |
| InChIKey | LQYDDSCWTUNOTM-HLZBLTOGSA-N |
| SMILES | O=P(O)(O)OC1OC(CO)C(O)C(O)C1O.[K].[K] |